Online Database of Chemicals from Around the World
| Name | Methyl N-Formylmethionylprolylphenylalaninate |
|---|---|
| Synonyms | N-formylmethionyl-prolyl-phenylalanine methyl ester |
| Molecular Structure |  |
| Molecular Formula | C21H29N3O5S |
| Molecular Weight | 435.54 |
| CAS Registry Number | 150178-44-2 |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)OC)C2CCCN2C(=O)C(CCSC)NC=O |
| InChI | 1S/C21H29N3O5S/c1-29-21(28)17(13-15-7-4-3-5-8-15)23-19(26)18-9-6-11-24(18)20(27)16(22-14-25)10-12-30-2/h3-5,7-8,14,16-18H,6,9-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | PJYRDJQVXPQKFT-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 736.042°C at 760 mmHg (Cal.) |
| Flash point | 398.944°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl N-Formylmethionylprolylphenylalaninate |
