Online Database of Chemicals from Around the World
|
CAS#: 150521-30-5 Product: (2R)-(4-Bromophenyl)(Hydroxy)Acetonitrile No suppilers available for the product. |
| Name | (2R)-(4-Bromophenyl)(Hydroxy)Acetonitrile |
|---|---|
| Synonyms | (R)-(+)-4-Bromomandelonitrile |
| Molecular Structure |  |
| Molecular Formula | C8H6BrNO |
| Molecular Weight | 212.04 |
| CAS Registry Number | 150521-30-5 |
| SMILES | C1=CC(=CC=C1[C@H](C#N)O)Br |
| InChI | 1S/C8H6BrNO/c9-7-3-1-6(2-4-7)8(11)5-10/h1-4,8,11H/t8-/m0/s1 |
| InChIKey | AYTVNJIUMVFUCJ-QMMMGPOBSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.6±27.0°C at 760 mmHg (Cal.) |
| Flash point | 171.9±23.7°C (Cal.) |
| Refractive index | 1.607 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-(4-Bromophenyl)(Hydroxy)Acetonitrile |