Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(2-Amino-3-Chloro-6-Methoxyphenyl)-2-Chloroethanone |
|---|---|
| Synonyms | 1-(2-amino-3-chloro-6-methoxyphenyl)-2-chloroethanone |
| Molecular Structure |  |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 |
| CAS Registry Number | 150805-98-4 |
| SMILES | Nc1c(C(=O)CCl)c(ccc1Cl)OC |
| InChI | 1S/C9H9Cl2NO2/c1-14-7-3-2-5(11)9(12)8(7)6(13)4-10/h2-3H,4,12H2,1H3 |
| InChIKey | QKYODYZOZRZJGO-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.693°C at 760 mmHg (Cal.) |
| Flash point | 177.385°C (Cal.) |
| Refractive index | 1.582 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Amino-3-Chloro-6-Methoxyphenyl)-2-Chloroethanone |