Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Dihydro Cuminyl Acetate |
|---|---|
| Synonyms | (4-Isopropenyl-1-Cyclohexenyl)Methyl Acetate; Acetic Acid (4-Isopropenyl-1-Cyclohexenyl)Methyl Ester; (4-Prop-1-En-2-Yl-1-Cyclohexenyl)Methyl Ethanoate |
| Molecular Structure |  |
| Molecular Weight | 194.27 |
| CAS Registry Number | 15111-96-3 |
| EINECS | 239-162-4 |
| SMILES | C(OC(=O)C)C1=CCC(CC1)C(=C)C |
| InChI | 1S/C12H18O2/c1-9(2)12-6-4-11(5-7-12)8-14-10(3)13/h4,12H,1,5-8H2,2-3H3 |
| InChIKey | WTXBCFKGCNWPLS-UHFFFAOYSA-N |
| Density | 0.967g/cm3 (Cal.) |
|---|---|
| Boiling point | 218-223°C (Expl.) |
| 258.36°C at 760 mmHg (Cal.) | |
| Flash point | 98.859°C (Cal.) |
| Refractive index | 1.476-1.487 (Expl.) |
| Market Analysis Reports |
| List of Reports Available for Dihydro Cuminyl Acetate |