Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Oxetanyl 2-Aminobenzoate |
|---|---|
| Synonyms | 3-Oxetanol,2-aminobenzoate; oxetan-3-yl 2-aminobenzoate |
| Molecular Structure |  |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 |
| CAS Registry Number | 151695-64-6 |
| SMILES | c1ccc(c(c1)C(=O)OC2COC2)N |
| InChI | 1S/C10H11NO3/c11-9-4-2-1-3-8(9)10(12)14-7-5-13-6-7/h1-4,7H,5-6,11H2 |
| InChIKey | ORQPRPXZUGMYRQ-UHFFFAOYSA-N |
| Density | 1.282g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.632°C at 760 mmHg (Cal.) |
| Flash point | 173.778°C (Cal.) |
| Refractive index | 1.584 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Oxetanyl 2-Aminobenzoate |