Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,3-Di-Iso-Propyl-5-Ethylbenzene |
|---|---|
| Synonyms | 1-Ethyl-3,5-Diisopropyl-Benzene; 1-Ethyl-3,5-Diisopropylbenzene; Benzene, 1,3-Diisopropyl-5-Ethyl- |
| Molecular Structure |  |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 |
| CAS Registry Number | 15181-13-2 |
| SMILES | C1=C(C=C(C=C1C(C)C)CC)C(C)C |
| InChI | 1S/C14H22/c1-6-12-7-13(10(2)3)9-14(8-12)11(4)5/h7-11H,6H2,1-5H3 |
| InChIKey | HWWKORYFZUHZKW-UHFFFAOYSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 237.162°C at 760 mmHg (Cal.) |
| Flash point | 90.225°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Di-Iso-Propyl-5-Ethylbenzene |