Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | N-Allyl-3-hydroxymorphinan |
|---|---|
| Synonyms | Levallorphane [Inn-French]; Levallorphanum [Inn-Latin]; Levalorfano [Inn-Spanish] |
| Molecular Structure |  |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 |
| CAS Registry Number | 152-02-3 |
| EINECS | 205-799-1 |
| SMILES | [C@]124[C@H]([C@H](N(CC=C)CC1)CC3=C2C=C(O)C=C3)CCCC4 |
| InChI | 1S/C19H25NO/c1-2-10-20-11-9-19-8-4-3-5-16(19)18(20)12-14-6-7-15(21)13-17(14)19/h2,6-7,13,16,18,21H,1,3-5,8-12H2/t16-,18+,19+/m0/s1 |
| InChIKey | OZYUPQUCAUTOBP-QXAKKESOSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.5±45.0°C at 760 mmHg (Cal.) |
| Flash point | 214.2±27.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Allyl-3-hydroxymorphinan |