Online Database of Chemicals from Around the World
|
CAS#: 15218-38-9 Product: Nojirimycin No suppilers available for the product. |
| Name | Nojirimycin |
|---|---|
| Synonyms | (3R,4S,5R,6R)-6-Methylolpiperidine-2,3,4,5-Tetrol; 5-Amino-5-Deoxy-D-Glucopyranose; C06763 |
| Molecular Structure |  |
| Molecular Formula | C6H13NO5 |
| Molecular Weight | 179.17 |
| CAS Registry Number | 15218-38-9 |
| SMILES | [C@H]1(O)[C@H](O)[C@H](NC(O)[C@@H]1O)CO |
| InChI | 1S/C6H13NO5/c8-1-2-3(9)4(10)5(11)6(12)7-2/h2-12H,1H2/t2-,3-,4+,5-,6?/m1/s1 |
| InChIKey | BGMYHTUCJVZIRP-GASJEMHNSA-N |
| Density | 1.644g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.331°C at 760 mmHg (Cal.) |
| Flash point | 214.335°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nojirimycin |