Online Database of Chemicals from Around the World
|
CAS#: 15233-34-8 Product: 3,4-Dichlorophenylbiguanide No suppilers available for the product. |
| Name | 3,4-Dichlorophenylbiguanide |
|---|---|
| Synonyms | 1-(Diaminomethylene)-2-(3,4-Dichlorophenyl)Guanidine; 3,4-Dichlorophenylbiguanide; Imidodicarbonimidic Diamide, N-(3,4-Dichlorophenyl)- |
| Molecular Structure |  |
| Molecular Formula | C8H9Cl2N5 |
| Molecular Weight | 246.10 |
| CAS Registry Number | 15233-34-8 |
| SMILES | C1=C(N=C(N=C(N)N)N)C=CC(=C1Cl)Cl |
| InChI | 1S/C8H9Cl2N5/c9-5-2-1-4(3-6(5)10)14-8(13)15-7(11)12/h1-3H,(H6,11,12,13,14,15) |
| InChIKey | ZJAWVBLMRPEUPW-UHFFFAOYSA-N |
| Density | 1.627g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.851°C at 760 mmHg (Cal.) |
| Flash point | 238.562°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dichlorophenylbiguanide |