| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.fine-chemtech.com | |||
![]() | +86 (25) 5207-8417 +86 17714198479 | |||
![]() | +86 (25) 5207-8417 | |||
![]() | sales@fine-chemtech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Name | (2S,4S)-1-tert-butyl 2-methyl 4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonyms | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18F3NO4 |
| Molecular Weight | 297.27 |
| CAS Registry Number | 1523541-90-3 |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)C(F)(F)F |
| Density | 1.3±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.439, Calc.* |
| Boiling Point | 294.4±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 131.8±27.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for (2S,4S)-1-tert-butyl 2-methyl 4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |