Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Methyl 3-(Trifluoromethyl)Phenyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | cyanocarbonimidodithioate; Methyl [3-(trifluoromethyl)phenyl]; Methyl [3-(trifluoromethyl)phenyl]cyanocarbonimidodithioate |
| Molecular Structure |  |
| Molecular Formula | C10H7F3N2S2 |
| Molecular Weight | 276.30 |
| CAS Registry Number | 152382-06-4 |
| SMILES | CSC(=NC#N)Sc1cccc(c1)C(F)(F)F |
| InChI | 1S/C10H7F3N2S2/c1-16-9(15-6-14)17-8-4-2-3-7(5-8)10(11,12)13/h2-5H,1H3/b15-9- |
| InChIKey | CMTYEWAYTUFVDX-DHDCSXOGSA-N |
| Density | 1.323g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.898°C at 760 mmHg (Cal.) |
| Flash point | 159.365°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 3-(Trifluoromethyl)Phenyl Cyanocarbonodithioimidate |