Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Methyl 4-Nitrophenyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | Methyl (4-nitrophenyl) cyanocarbonimidodithioate; ZINC04290425; ZINC04716405 |
| Molecular Structure |  |
| Molecular Formula | C9H7N3O2S2 |
| Molecular Weight | 253.30 |
| CAS Registry Number | 152382-10-0 |
| SMILES | [O-][N+](=O)c1ccc(SC(\SC)=N\C#N)cc1 |
| InChI | 1S/C9H7N3O2S2/c1-15-9(11-6-10)16-8-4-2-7(3-5-8)12(13)14/h2-5H,1H3/b11-9+ |
| InChIKey | RFQIKDFVZRXRIQ-PKNBQFBNSA-N |
| Density | 1.376g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.226°C at 760 mmHg (Cal.) |
| Flash point | 212.179°C (Cal.) |
| Refractive index | 1.655 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-Nitrophenyl Cyanocarbonodithioimidate |