|
CAS#: 152382-12-2 Product: Methyl 4-Sulfamoylphenyl Cyanocarbonodithioimidate No suppilers available for the product. |
| Name | Methyl 4-Sulfamoylphenyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | (4-Aminosulfonylphenyl) methyl; (4-Aminosulfonylphenyl) methylcyanocarbonimidodithioate; cyanocarbonimidodithioate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9N3O2S3 |
| Molecular Weight | 287.38 |
| CAS Registry Number | 152382-12-2 |
| SMILES | CSC(=NC#N)Sc1ccc(cc1)S(=O)(=O)N |
| InChI | 1S/C9H9N3O2S3/c1-15-9(12-6-10)16-7-2-4-8(5-3-7)17(11,13)14/h2-5H,1H3,(H2,11,13,14)/b12-9- |
| InChIKey | ADHGVZFHMDXNEX-XFXZXTDPSA-N |
| Density | 1.468g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.84°C at 760 mmHg (Cal.) |
| Flash point | 256.699°C (Cal.) |
| Refractive index | 1.674 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-Sulfamoylphenyl Cyanocarbonodithioimidate |