Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,5-Dichlorophenyl Methyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | (2,5-Dichlorophenyl) methyl; (2,5-Dichlorophenyl) methylcyanocarbonimidodithioate; cyanocarbonimidodithioate |
| Molecular Structure |  |
| Molecular Formula | C9H6Cl2N2S2 |
| Molecular Weight | 277.19 |
| CAS Registry Number | 152382-16-6 |
| SMILES | CSC(=NC#N)Sc1cc(ccc1Cl)Cl |
| InChI | 1S/C9H6Cl2N2S2/c1-14-9(13-5-12)15-8-4-6(10)2-3-7(8)11/h2-4H,1H3/b13-9- |
| InChIKey | ACPPCWZYCZXFHW-LCYFTJDESA-N |
| Density | 1.405g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.918°C at 760 mmHg (Cal.) |
| Flash point | 186.592°C (Cal.) |
| Refractive index | 1.64 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Dichlorophenyl Methyl Cyanocarbonodithioimidate |