|
CAS#: 152382-31-5 Product: 2,6-Diethylphenyl Methyl Cyanocarbonodithioimidate No suppilers available for the product. |
| Name | 2,6-Diethylphenyl Methyl Cyanocarbonodithioimidate |
|---|---|
| Synonyms | (2,6-Diethylphenyl) methyl; (2,6-Diethylphenyl) methylcyanocarbonimidodithioate; cyanocarbonimidodithioate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N2S2 |
| Molecular Weight | 264.41 |
| CAS Registry Number | 152382-31-5 |
| SMILES | N#C\N=C(/SC)Sc1c(cccc1CC)CC |
| InChI | 1S/C13H16N2S2/c1-4-10-7-6-8-11(5-2)12(10)17-13(16-3)15-9-14/h6-8H,4-5H2,1-3H3/b15-13+ |
| InChIKey | VVDXKIDVEWRIHC-FYWRMAATSA-N |
| Density | 1.096g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.496°C at 760 mmHg (Cal.) |
| Flash point | 182.708°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diethylphenyl Methyl Cyanocarbonodithioimidate |