Online Database of Chemicals from Around the World
|
CAS#: 15269-50-8 Product: 1-(4-Methoxybenzoyl)Aziridine No suppilers available for the product. |
| Name | 1-(4-Methoxybenzoyl)Aziridine |
|---|---|
| Synonyms | 1-Aziridinyl-(4-Methoxyphenyl)Methanone; Ethylenimino-(4-Methoxyphenyl)Methanone; 1-(P-Methoxybenzoyl)Aziridine |
| Molecular Structure |  |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 |
| CAS Registry Number | 15269-50-8 |
| SMILES | C1=CC(=CC=C1OC)C(=O)N2CC2 |
| InChI | 1S/C10H11NO2/c1-13-9-4-2-8(3-5-9)10(12)11-6-7-11/h2-5H,6-7H2,1H3 |
| InChIKey | HXICBHVTWBDOFR-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.837°C at 760 mmHg (Cal.) |
| Flash point | 153.885°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Methoxybenzoyl)Aziridine |