| Classification | Biochemical >> Amino acids and their derivatives >> Alanine derivatives |
|---|---|
| Name | 2-Amino-4-(3-Nitrophenyl)-4-Oxobutanoic Acid |
| Synonyms | 2-Amino-4-(3-Nitrophenyl)-4-Oxo-Butanoic Acid; 2-Amino-4-Keto-4-(3-Nitrophenyl)Butyric Acid; (3-Nitrobenzoyl)Alanine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O5 |
| Molecular Weight | 238.20 |
| CAS Registry Number | 153212-71-6 |
| SMILES | C1=C(C=CC=C1C(CC(C(O)=O)N)=O)[N+](=O)[O-] |
| InChI | 1S/C10H10N2O5/c11-8(10(14)15)5-9(13)6-2-1-3-7(4-6)12(16)17/h1-4,8H,5,11H2,(H,14,15) |
| InChIKey | KBJZPNMDKSNLIZ-UHFFFAOYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.27°C at 760 mmHg (Cal.) |
| Flash point | 222.487°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-4-(3-Nitrophenyl)-4-Oxobutanoic Acid |