Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl (2Z)-2-[Methyl(Oxido)-lambda5-Azanylidene]Propanoate |
|---|---|
| Synonyms | (Z)-N-(1-ethoxy-1-oxopropan-2-ylidene)methanamine oxide |
| Molecular Structure | ![CAS#: 153434-26-5， Ethyl (2Z)-2-[Methyl(Oxido)-lambda<Sup>5</Sup>-Azanylidene]Propanoate](/moreStructures/153434-26-5.gif) |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 |
| CAS Registry Number | 153434-26-5 |
| SMILES | [O-]\[N+](=C(/C(=O)OCC)C)C |
| InChI | 1S/C6H11NO3/c1-4-10-6(8)5(2)7(3)9/h4H2,1-3H3/b7-5- |
| InChIKey | FMMQETWLOGSMCG-ALCCZGGFSA-N |
| Density | 1.037g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.903°C at 760 mmHg (Cal.) |
| Flash point | 94.461°C (Cal.) |
| Refractive index | 1.446 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (2Z)-2-[Methyl(Oxido)-lambda5-Azanylidene]Propanoate |