Online Database of Chemicals from Around the World
| DSL Chemicals (Shanghai) Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (21) 6352-9955 | |||
 |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Tert-Butoxyanisole |
|---|---|
| Synonyms | 1-Tert-Butoxy-4-Methoxy-Benzene; 1-Tert-Butoxy-4-Methoxybenzene; P-Tert-Butoxyanisole |
| Molecular Structure |  |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 |
| CAS Registry Number | 15360-00-6 |
| EINECS | 239-397-2 |
| SMILES | C1=C(OC(C)(C)C)C=CC(=C1)OC |
| InChI | 1S/C11H16O2/c1-11(2,3)13-10-7-5-9(12-4)6-8-10/h5-8H,1-4H3 |
| InChIKey | SOEWHLJEXIKEPN-UHFFFAOYSA-N |
| Density | 0.964g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.261°C at 760 mmHg (Cal.) |
| Flash point | 86.58°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Tert-Butoxyanisole |