| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Apremilast EP Impurity B |
|---|---|
| Synonyms | 3-Acetamidophthalic acid;3-(Acetylamino)-1,2-benzenedicarboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO5 |
| Molecular Weight | 223.18 |
| CAS Registry Number | 15371-06-9 |
| EC Number | 239-404-9 |
| SMILES | CC(=O)NC1=CC=CC(=C1C(=O)O)C(=O)O |
| Solubility | 1630 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.659, Calc.* |
| Melting point | 198.96 °C |
| Boiling Point | 470.81 °C, 518.2±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 267.2±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H317-H341-H351-H361-H413 Details | ||||||||||||||||||||||||
| Safety Statements | P203-P261-P272-P273-P280-P281-P302+P352-P318-P321-P333+P313-P362+P364-P405-P501 Details | ||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||
| |||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Apremilast EP Impurity B |