Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Allyl 3-Amino-5-Cyanobenzoate |
|---|---|
| Synonyms | allyl 3-amino-5-cyanobenzoate |
| Molecular Structure |  |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 153774-83-5 |
| SMILES | N#Cc1cc(cc(N)c1)C(=O)OCC=C |
| InChI | 1S/C11H10N2O2/c1-2-3-15-11(14)9-4-8(7-12)5-10(13)6-9/h2,4-6H,1,3,13H2 |
| InChIKey | KXPLOHCJQOKXRG-UHFFFAOYSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.475°C at 760 mmHg (Cal.) |
| Flash point | 194.791°C (Cal.) |
| Refractive index | 1.571 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allyl 3-Amino-5-Cyanobenzoate |