|
CAS#: 15396-37-9 Product: 3,5-Dichloro-2-Iodo-Benzoic Acid No suppilers available for the product. |
| Name | 3,5-Dichloro-2-Iodo-Benzoic Acid |
|---|---|
| Synonyms | 3,5-Dichloro-2-Iodo-Benzoate; Zinc03886214 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H2Cl2IO2 |
| Molecular Weight | 315.90 |
| CAS Registry Number | 15396-37-9 |
| SMILES | C1=C(Cl)C=C(Cl)C(=C1C([O-])=O)I |
| InChI | 1S/C7H3Cl2IO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,(H,11,12)/p-1 |
| InChIKey | DJTJHMZDOREVFA-UHFFFAOYSA-M |
| Boiling point | 363.953°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 173.913°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-2-Iodo-Benzoic Acid |