| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 2,5-Bis(3-Pyridyl)-1,3,4-Oxadiazole |
|---|---|
| Synonyms | 3-[5-(3-Pyridyl)-1,3,4-Oxadiazol-2-Yl]Pyridine; Nsc176078; 3,3'-(1,3,4-Oxadiazol-2,5-Ylene)Dipyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8N4O |
| Molecular Weight | 224.22 |
| CAS Registry Number | 15420-57-2 |
| SMILES | C1=NC=CC=C1C2=NN=C(O2)C3=CC=CN=C3 |
| InChI | 1S/C12H8N4O/c1-3-9(7-13-5-1)11-15-16-12(17-11)10-4-2-6-14-8-10/h1-8H |
| InChIKey | DTUMGCJGZSNWCF-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.873°C at 760 mmHg (Cal.) |
| Flash point | 229.306°C (Cal.) |
| (1) | Jing Chen, Cheng-Peng Li and Miao Du. Substituent effect of R-isophthalates (R = –H, –CH, –OCH, –tBu, –OH, and –NO) on the construction of CdII coordination polymers incorporating a dipyridyl tecton 2,5-bis(3-pyridyl)-1,3,4-oxadiazole, CrystEngComm, 2011, 13, 1885. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis(3-Pyridyl)-1,3,4-Oxadiazole |