Online Database of Chemicals from Around the World
| Name | 2,2'-Dibromoazobenzene |
|---|---|
| Synonyms | Diazene, Bis(2-Bromophenyl)-; Nsc168931; (E)-1,2-Bis(2-Bromophenyl)Diazene |
| Molecular Structure |  |
| Molecular Formula | C12H8Br2N2 |
| Molecular Weight | 340.02 |
| CAS Registry Number | 15426-16-1 |
| SMILES | C1=CC=CC(=C1N=NC2=C(C=CC=C2)Br)Br |
| InChI | 1S/C12H8Br2N2/c13-9-5-1-3-7-11(9)15-16-12-8-4-2-6-10(12)14/h1-8H |
| InChIKey | PLBYCASTSHVECW-UHFFFAOYSA-N |
| Density | 1.672g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.103°C at 760 mmHg (Cal.) |
| Flash point | 203.638°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-Dibromoazobenzene |
