Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Diethyl 2,6-Naphthalenedicarboxylate |
|---|---|
| Synonyms | 2,6-Naphthalenedicarboxylic acid diethyl ester |
| Molecular Structure |  |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 15442-73-6 |
| SMILES | CCOC(=O)c1ccc2cc(ccc2c1)C(=O)OCC |
| InChI | 1S/C16H16O4/c1-3-19-15(17)13-7-5-12-10-14(16(18)20-4-2)8-6-11(12)9-13/h5-10H,3-4H2,1-2H3 |
| InChIKey | CSNCOKSAYUDNIE-UHFFFAOYSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.323°C at 760 mmHg (Cal.) |
| Flash point | 199.726°C (Cal.) |
| Refractive index | 1.576 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diethyl 2,6-Naphthalenedicarboxylate |