Online Database of Chemicals from Around the World
|
CAS#: 15450-73-4 Product: 1H-Quinoline-2,5,8-Trione No suppilers available for the product. |
| Name | 1H-Quinoline-2,5,8-Trione |
|---|---|
| Synonyms | 2,5,8(1H)-Quinolinetrione; Nsc107098 |
| Molecular Structure |  |
| Molecular Formula | C9H5NO3 |
| Molecular Weight | 175.14 |
| CAS Registry Number | 15450-73-4 |
| SMILES | O=C1C=CC(=O)C2=C1NC(=O)C=C2 |
| InChI | 1S/C9H5NO3/c11-6-2-3-7(12)9-5(6)1-4-8(13)10-9/h1-4H,(H,10,13) |
| InChIKey | JXTKZMFPFKZRHP-UHFFFAOYSA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 457.613°C at 760 mmHg (Cal.) |
| Flash point | 224.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1H-Quinoline-2,5,8-Trione |