Online Database of Chemicals from Around the World
|
CAS#: 15451-29-3 Product: 3-(Dimethylamino)-2,2-Dimethyl-1-Phenyl-1-Propanone No suppilers available for the product. |
| Name | 3-(Dimethylamino)-2,2-Dimethyl-1-Phenyl-1-Propanone |
|---|---|
| Synonyms | 3-Dimethylamino-2,2-Dimethyl-1-Phenyl-Propan-1-One; 2,2-Dimethyl-3-(Dimethylamino)-Propiophenone; 3-14-00-00178 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 |
| CAS Registry Number | 15451-29-3 |
| SMILES | C1=C(C(C(CN(C)C)(C)C)=O)C=CC=C1 |
| InChI | 1S/C13H19NO/c1-13(2,10-14(3)4)12(15)11-8-6-5-7-9-11/h5-9H,10H2,1-4H3 |
| InChIKey | WKJYCZMXCFRIEO-UHFFFAOYSA-N |
| Density | 0.974g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.456°C at 760 mmHg (Cal.) |
| Flash point | 94.493°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Dimethylamino)-2,2-Dimethyl-1-Phenyl-1-Propanone |