Online Database of Chemicals from Around the World
|
CAS#: 15453-08-4 Product: 4,5-Epoxy-1,1,2,3,3,4,5,5-Octafluoropent-1-Ene No suppilers available for the product. |
| Name | 4,5-Epoxy-1,1,2,3,3,4,5,5-Octafluoropent-1-Ene |
|---|---|
| Synonyms | 4,5-Epoxy-1,1,2,3,3,4,5,5-Octafluoropent-1-Ene |
| Molecular Structure |  |
| Molecular Formula | C5F8O |
| CAS Registry Number | 15453-08-4 |
| EINECS | 239-469-3 |
| SMILES | C(C(C1(C(F)(O1)F)F)(F)F)(=C(F)F)F |
| InChI | 1S/C5F8O/c6-1(2(7)8)3(9,10)4(11)5(12,13)14-4 |
| InChIKey | ZHOFEJCLMUIOIW-UHFFFAOYSA-N |
| Density | 1.685g/cm3 (Cal.) |
|---|---|
| Boiling point | 52.605°C at 760 mmHg (Cal.) |
| Flash point | -9.516°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Epoxy-1,1,2,3,3,4,5,5-Octafluoropent-1-Ene |