Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 5-Nitroso-Salicylate |
|---|---|
| Synonyms | 2-Hydroxy-5-Nitroso-Benzoic Acid; 5-Nitroso-Salicylate; Benzoic Acid, 2-Hydroxy-5-Nitroso- |
| Molecular Structure |  |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 |
| CAS Registry Number | 15516-60-6 |
| SMILES | C1=C(C(=CC(=C1)N=O)C(=O)O)O |
| InChI | 1S/C7H5NO4/c9-6-2-1-4(8-12)3-5(6)7(10)11/h1-3,9H,(H,10,11) |
| InChIKey | UNQLIDLZZNHURS-UHFFFAOYSA-N |
| Density | 1.512g/cm3 (Cal.) |
|---|---|
| Boiling point | 402.657°C at 760 mmHg (Cal.) |
| Flash point | 197.32°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitroso-Salicylate |