Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(1R,2R)-2-Ethynylcyclopentyl]Ethanone |
|---|---|
| Synonyms | 1-((1R,2R)-2-ethynylcyclopentyl)ethanone |
| Molecular Structure | ![CAS#: 155222-54-1， 1-[(1R,2R)-2-Ethynylcyclopentyl]Ethanone](/moreStructures/155222-54-1.gif) |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 |
| CAS Registry Number | 155222-54-1 |
| SMILES | CC(=O)[C@@H]1CCC[C@H]1C#C |
| InChI | 1S/C9H12O/c1-3-8-5-4-6-9(8)7(2)10/h1,8-9H,4-6H2,2H3/t8-,9+/m1/s1 |
| InChIKey | IRVCGZWYHYJZTB-BDAKNGLRSA-N |
| Density | 0.96g/cm3 (Cal.) |
|---|---|
| Boiling point | 188.92°C at 760 mmHg (Cal.) |
| Flash point | 64.468°C (Cal.) |
| Refractive index | 1.469 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1R,2R)-2-Ethynylcyclopentyl]Ethanone |