Online Database of Chemicals from Around the World
| Name | 3-(2,5-Dichlorophenyl)-1,1-Diethylurea |
|---|---|
| Synonyms | 3-(2,5-Dichlorophenyl)-1,1-Diethyl-Urea; Nsc190742; Urea, 3-(2,5-Dichlorophenyl)-1,1-Diethyl- |
| Molecular Structure |  |
| Molecular Formula | C11H14Cl2N2O |
| Molecular Weight | 261.15 |
| CAS Registry Number | 15545-51-4 |
| SMILES | C1=C(Cl)C=CC(=C1NC(N(CC)CC)=O)Cl |
| InChI | 1S/C11H14Cl2N2O/c1-3-15(4-2)11(16)14-10-7-8(12)5-6-9(10)13/h5-7H,3-4H2,1-2H3,(H,14,16) |
| InChIKey | WVSZEMHNNZDAFV-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.262°C at 760 mmHg (Cal.) |
| Flash point | 194.057°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(2,5-Dichlorophenyl)-1,1-Diethylurea |
