Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-Acryloyl-L-Prolinamide |
|---|---|
| Synonyms | (S)-1-acryloylpyrrolidine-2-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.19 |
| CAS Registry Number | 155540-07-1 |
| SMILES | O=C(N)[C@H]1N(C(=O)\C=C)CCC1 |
| InChI | 1S/C8H12N2O2/c1-2-7(11)10-5-3-4-6(10)8(9)12/h2,6H,1,3-5H2,(H2,9,12)/t6-/m0/s1 |
| InChIKey | JHWOKCJZMOYRCF-LURJTMIESA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.639°C at 760 mmHg (Cal.) |
| Flash point | 224.524°C (Cal.) |
| Refractive index | 1.532 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Acryloyl-L-Prolinamide |