Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,3,4,5,6-Hexakis-O-(3-Pyridinylcarbonyl)-D-Mannitol |
|---|---|
| Synonyms | D-mannitol hexanicotinate |
| Molecular Structure |  |
| Molecular Formula | C42H32N6O12 |
| Molecular Weight | 812.74 |
| CAS Registry Number | 15596-27-7 |
| EINECS | 239-676-9 |
| SMILES | O=C(O[C@H](COC(=O)c1cccnc1)[C@@H](OC(=O)c2cccnc2)[C@H](OC(=O)c3cccnc3)[C@@H](COC(=O)c4cccnc4)OC(=O)c5cccnc5)c6cccnc6 |
| InChI | 1S/C42H32N6O12/c49-37(27-7-1-13-43-19-27)55-25-33(57-39(51)29-9-3-15-45-21-29)35(59-41(53)31-11-5-17-47-23-31)36(60-42(54)32-12-6-18-48-24-32)34(58-40(52)30-10-4-16-46-22-30)26-56-38(50)28-8-2-14-44-20-28/h1-24,33-36H,25-26H2/t33-,34-,35-,36-/m1/s1 |
| InChIKey | IMRLNFKFNFLWQF-MGXDLYCJSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 965.488°C at 760 mmHg (Cal.) |
| Flash point | 537.708°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,5,6-Hexakis-O-(3-Pyridinylcarbonyl)-D-Mannitol |