|
CAS#: 156185-88-5 Product: 3-Amino-N-(Phenylsulfonyl)-L-Alanine No suppilers available for the product. |
| Name | 3-Amino-N-(Phenylsulfonyl)-L-Alanine |
|---|---|
| Synonyms | 3-Amino-(2S)-phenylsulfonylaminopropionicacid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 |
| CAS Registry Number | 156185-88-5 |
| SMILES | O=S(=O)(N[C@H](C(=O)O)CN)c1ccccc1 |
| InChI | 1S/C9H12N2O4S/c10-6-8(9(12)13)11-16(14,15)7-4-2-1-3-5-7/h1-5,8,11H,6,10H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | QSCVWHIJUJGFDU-QMMMGPOBSA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.885°C at 760 mmHg (Cal.) |
| Flash point | 235.559°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-N-(Phenylsulfonyl)-L-Alanine |