|
CAS#: 156835-63-1 Product: (3S,4S)-2,5-Dioxotetrahydrofuran-3,4-Diyl Bis(4-Methylbenzoate) No suppilers available for the product. |
| Name | (3S,4S)-2,5-Dioxotetrahydrofuran-3,4-Diyl Bis(4-Methylbenzoate) |
|---|---|
| Synonyms | (3S,4S)-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H16O7 |
| Molecular Weight | 368.34 |
| CAS Registry Number | 156835-63-1 |
| SMILES | Cc1ccc(cc1)C(=O)O[C@H]2[C@@H](C(=O)OC2=O)OC(=O)c3ccc(cc3)C |
| InChI | 1S/C20H16O7/c1-11-3-7-13(8-4-11)17(21)25-15-16(20(24)27-19(15)23)26-18(22)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | BCIJHROJBLWCLV-HOTGVXAUSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.2±50.0°C at 760 mmHg (Cal.) |
| Flash point | 246.0±30.2°C (Cal.) |
| Refractive index | 1.602 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (3S,4S)-2,5-Dioxotetrahydrofuran-3,4-Diyl Bis(4-Methylbenzoate) |