| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| RIA International LLC | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Classification | API >> Blood system medication >> Anticoagulant and antiplatelet drugs |
|---|---|
| Name | Naftazone |
| Synonyms | 2-Semicarbazono-1(2H)-Naphthalinon; Karbinone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 |
| CAS Registry Number | 15687-37-3 |
| EINECS | 239-785-1 |
| SMILES | C1=CC=CC2=C1C(\C(=N\NC(N)=O)C=C2)=O |
| InChI | 1S/C11H9N3O2/c12-11(16)14-13-9-6-5-7-3-1-2-4-8(7)10(9)15/h1-6H,(H3,12,14,16)/b13-9+ |
| InChIKey | TZGBBMBARSFJBG-UKTHLTGXSA-N |
| Density | 1.403g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Naftazone |