Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (2R)-Methoxy(2-Naphthyl)Acetic Acid |
|---|---|
| Synonyms | (R)-¦Á-Methoxy-2-naphthylacetic acid |
| Molecular Structure |  |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.23 |
| CAS Registry Number | 156942-67-5 |
| SMILES | O=C(O)[C@H](OC)c2ccc1c(cccc1)c2 |
| InChI | 1S/C13H12O3/c1-16-12(13(14)15)11-7-6-9-4-2-3-5-10(9)8-11/h2-8,12H,1H3,(H,14,15)/t12-/m1/s1 |
| InChIKey | OQVFHDWREDKUCW-GFCCVEGCSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.192°C at 760 mmHg (Cal.) |
| Flash point | 155.028°C (Cal.) |
| Refractive index | 1.623 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (2R)-Methoxy(2-Naphthyl)Acetic Acid |