| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Name | Vanadium(IV) etioporphyrin III oxide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C32H38Cl2N4OV |
| CAS Registry Number | 15709-03-2 |
| SMILES | Cl.Cl.CCc1c(C)c2\C=C8/N3=C(/C=C4C(\CC)=C(\C)/C5=C/C=7/C(/CC)=C(/C)\C\6=C\c1n2[V]3(=O)(N45)N/6=7)\C(\CC)=C8\C |
| InChI | 1S/C32H36N4.2ClH.O.V/c1-9-21-17(5)25-13-26-18(6)23(11-3)31(34-26)16-32-24(12-4)20(8)28(36-32)15-30-22(10-2)19(7)27(35-30)14-29(21)33-25;;;;/h13-16H,9-12H2,1-8H3;2*1H;;/q-2;;;;+2/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;;;; |
| InChIKey | PQPGNZDWUUIKLF-VLVLVZPCSA-N |
| Refractive index | (Cal.) |
|---|---|
| Safety Description | CAUTION: Dust may irritate eyes and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Vanadium(IV) etioporphyrin III oxide |