Online Database of Chemicals from Around the World
|
CAS#: 15725-17-4 Product: 3-(4-Methoxybenzylidene)Pentane-2,4-Dione No suppilers available for the product. |
| Name | 3-(4-Methoxybenzylidene)Pentane-2,4-Dione |
|---|---|
| Synonyms | 3-[(4-Methoxyphenyl)Methylene]Pentane-2,4-Dione; 3-(4-Methoxybenzylidene)Pentane-2,4-Dione; Nsc637168 |
| Molecular Structure |  |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 |
| CAS Registry Number | 15725-17-4 |
| SMILES | C1=C(C=C(C(=O)C)C(=O)C)C=CC(=C1)OC |
| InChI | 1S/C13H14O3/c1-9(14)13(10(2)15)8-11-4-6-12(16-3)7-5-11/h4-8H,1-3H3 |
| InChIKey | ANEDNAUPNRTQKL-UHFFFAOYSA-N |
| Density | 1.102g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.1°C at 760 mmHg (Cal.) |
| Flash point | 187.946°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Methoxybenzylidene)Pentane-2,4-Dione |