| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | Inquire | ||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 2-Methyl-2-Propanyl (2-Iodo-4-Methoxyphenyl)Carbamate |
|---|---|
| Synonyms | tert-butyl 2-iodo-4-methoxyphenylcarbamate; AI-942/42302123; ZINC00334580 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16INO3 |
| Molecular Weight | 349.16 |
| CAS Registry Number | 157496-75-8 |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)OC)I |
| InChI | 1S/C12H16INO3/c1-12(2,3)17-11(15)14-10-6-5-8(16-4)7-9(10)13/h5-7H,1-4H3,(H,14,15) |
| InChIKey | QVVBFDVJTIYVAU-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.8±32.0°C at 760 mmHg (Cal.) |
| Flash point | 160.5±25.1°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| (1) | Dimitrios E. Lizos and John A. Murphy. Concise synthesis of (±)-horsfiline and (±)-coerulescine by tandem cyclisation of iodoaryl alkenyl azides, Org. Biomol. Chem., 2003, 1, 117. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl (2-Iodo-4-Methoxyphenyl)Carbamate |