Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (201) 478-8534 | |||
|
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2,6-Naphthalenediylbis[(2,6-Dimethyl-1-Naphthyl)Methanone] |
|---|---|
| Synonyms | 2,6-Bis(2,6-dimethyl-1-naphthoyl)naphthalene |
| Molecular Structure | ![CAS#: 157585-49-4， 2,6-Naphthalenediylbis[(2,6-Dimethyl-1-Naphthyl)Methanone]](/moreStructures/157585-49-4.gif) |
| Molecular Formula | C36H28O2 |
| Molecular Weight | 492.61 |
| CAS Registry Number | 157585-49-4 |
| SMILES | Cc1ccc2c(c1)ccc(c2C(=O)c3ccc4cc(ccc4c3)C(=O)c5c(ccc6c5ccc(c6)C)C)C |
| InChI | 1S/C36H28O2/c1-21-5-15-31-27(17-21)9-7-23(3)33(31)35(37)29-13-11-26-20-30(14-12-25(26)19-29)36(38)34-24(4)8-10-28-18-22(2)6-16-32(28)34/h5-20H,1-4H3 |
| InChIKey | JWNNRHQJCSQBPN-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Melting point | 260°C (Expl.) |
| Boiling point | 678.48°C at 760 mmHg (Cal.) |
| Flash point | 242.306°C (Cal.) |
| Refractive index | 1.694 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Naphthalenediylbis[(2,6-Dimethyl-1-Naphthyl)Methanone] |