Online Database of Chemicals from Around the World
| Name | 1-Methoxy-10H-Phenothiazine |
|---|---|
| Synonyms | 1-Methoxyphenothiazine; 10H-Phenothiazine, 1-Methoxy-; Nsc516782 |
| Molecular Structure |  |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 |
| CAS Registry Number | 1576-70-1 |
| SMILES | C1=CC=CC2=C1SC3=C(N2)C(=CC=C3)OC |
| InChI | 1S/C13H11NOS/c1-15-10-6-4-8-12-13(10)14-9-5-2-3-7-11(9)16-12/h2-8,14H,1H3 |
| InChIKey | ROGKOUKGHMDPLN-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.606°C at 760 mmHg (Cal.) |
| Flash point | 199.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-10H-Phenothiazine |
