Online Database of Chemicals from Around the World
|
CAS#: 15764-04-2 Product: alpha-Vetivone No suppilers available for the product. |
| Name | alpha-Vetivone |
|---|---|
| Synonyms | (4R,4As)-6-Isopropylidene-4,4A-Dimethyl-4,5,7,8-Tetrahydro-3H-Naphthalen-2-One; C09744; Alpha-Vetivone |
| Molecular Structure |  |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 |
| CAS Registry Number | 15764-04-2 |
| EINECS | 239-855-1 |
| SMILES | [C@]12(C(=CC(=O)C[C@H]1C)CCC(C2)=C(C)C)C |
| InChI | 1S/C15H22O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11H,5-7,9H2,1-4H3/t11-,15+/m1/s1 |
| InChIKey | NIIPDXITZPFFTE-ABAIWWIYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.6±42.0°C at 760 mmHg (Cal.) |
| Flash point | 147.1±18.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Vetivone |