Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | Acetanilide-2',3',4',5',6'-D5 |
|---|---|
| Synonyms | N-(2,3,4,5,6-Pentadeuteriophenyl)Ethanamide; 2',3',4',5',6'-Pentadeuteroacetanilide; Acetamide, N-(Phenyl-D5)- |
| Molecular Structure |  |
| Molecular Formula | C8H4D5NO |
| Molecular Weight | 140.20 |
| CAS Registry Number | 15826-91-2 |
| EINECS | 239-928-8 |
| SMILES | C1(=C(C(=C(C(=C1NC(C)=O)[2H])[2H])[2H])[2H])[2H] |
| InChI | 1S/C8H9NO/c1-7(10)9-8-5-3-2-4-6-8/h2-6H,1H3,(H,9,10)/i2D,3D,4D,5D,6D |
| InChIKey | FZERHIULMFGESH-VIQYUKPQSA-N |
| Density | 1.144g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.5°C at 760 mmHg (Cal.) |
| Flash point | 173.946°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Acetanilide-2',3',4',5',6'-D5 |