|
CAS#: 158271-95-5 Product: 1-[(1R)-2-Hydroxy-1-Phenylethyl]-5H-Pyrrol-2-One No suppilers available for the product. |
| Name | 1-[(1R)-2-Hydroxy-1-Phenylethyl]-5H-Pyrrol-2-One |
|---|---|
| Synonyms | 1-[(1R)-2-Hydroxy-1-Phenyl-Ethyl]-5H-Pyrrol-2-One; 1-[(1R)-2-Hydroxy-1-Phenyl-Ethyl]-3-Pyrrolin-2-One; Zinc02511837 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 158271-95-5 |
| SMILES | [C@@H](N1C(C=CC1)=O)(C2=CC=CC=C2)CO |
| InChI | 1S/C12H13NO2/c14-9-11(10-5-2-1-3-6-10)13-8-4-7-12(13)15/h1-7,11,14H,8-9H2/t11-/m0/s1 |
| InChIKey | IPPHIZDKNVGDJX-NSHDSACASA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.386°C at 760 mmHg (Cal.) |
| Flash point | 217.114°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1R)-2-Hydroxy-1-Phenylethyl]-5H-Pyrrol-2-One |