Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 7,7-Dimethyltricyclo[2.2.1.02,6]Heptane-1-Carbonyl Fluoride |
|---|---|
| Synonyms | 7,7-dimethyltricyclo[2.2.1.02,6]heptane-1-carbonyl fluoride |
| Molecular Structure | ![CAS#: 1583-42-2， 7,7-Dimethyltricyclo[2.2.1.0<Sup>2,6</Sup>]Heptane-1-Carbonyl Fluoride](/moreStructures/1583-42-2.gif) |
| Molecular Formula | C10H13FO |
| Molecular Weight | 168.21 |
| CAS Registry Number | 1583-42-2 |
| SMILES | CC1(C2CC3C1(C3C2)C(=O)F)C |
| InChI | 1S/C10H13FO/c1-9(2)5-3-6-7(4-5)10(6,9)8(11)12/h5-7H,3-4H2,1-2H3 |
| InChIKey | VENOPFUEOLTHDE-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 196.334°C at 760 mmHg (Cal.) |
| Flash point | 72.703°C (Cal.) |
| Refractive index | 1.519 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,7-Dimethyltricyclo[2.2.1.02,6]Heptane-1-Carbonyl Fluoride |