Online Database of Chemicals from Around the World
|
CAS#: 15869-74-6 Product: 1,2,3,4,6,7,8,9-Octahydrodibenzothiophene No suppilers available for the product. |
| Name | 1,2,3,4,6,7,8,9-Octahydrodibenzothiophene |
|---|---|
| Synonyms | Octahydrodibenzothiophene; 1,2,3,4,5,6,7,8-Octahydro-9-Thiafluorene; Nciopen2_001629 |
| Molecular Structure |  |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.32 |
| CAS Registry Number | 15869-74-6 |
| SMILES | C1C2=C(CCC1)C3=C(S2)CCCC3 |
| InChI | 1S/C12H16S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h1-8H2 |
| InChIKey | YVGLPSLTCJFUMY-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.72°C at 760 mmHg (Cal.) |
| Flash point | 101.175°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,6,7,8,9-Octahydrodibenzothiophene |