Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Methyl-1,2,3-Propanetricarboxylicacid |
|---|---|
| Synonyms | 2-Methyl-1,2,3-Propanetricarboxylic Acid; Ncgc00013768; Nsc-66538 |
| Molecular Structure |  |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 |
| CAS Registry Number | 1590-02-9 |
| EINECS | 216-460-2 |
| SMILES | C(C(CC(O)=O)(C(O)=O)C)C(O)=O |
| InChI | 1S/C7H10O6/c1-7(6(12)13,2-4(8)9)3-5(10)11/h2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | GPICKHDXBPTBLD-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.348°C at 760 mmHg (Cal.) |
| Flash point | 133.363°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1,2,3-Propanetricarboxylicacid |