Online Database of Chemicals from Around the World
|
CAS#: 15909-68-9 Product: Methyl D-Arabinonate No suppilers available for the product. |
| Name | Methyl D-Arabinonate |
|---|---|
| Synonyms | methyl arabinonate; NSC 80653 |
| Molecular Structure |  |
| Molecular Formula | C6H12O6 |
| Molecular Weight | 180.16 |
| CAS Registry Number | 15909-68-9 |
| SMILES | O=C(OC)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | 1S/C6H12O6/c1-12-6(11)5(10)4(9)3(8)2-7/h3-5,7-10H,2H2,1H3/t3-,4-,5+/m1/s1 |
| InChIKey | JWILWRLEBBNTFH-WDCZJNDASA-N |
| Density | 1.474g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.736°C at 760 mmHg (Cal.) |
| Flash point | 172.142°C (Cal.) |
| Refractive index | 1.528 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl D-Arabinonate |