|
CAS#: 159390-26-8 Product: N,N'-Bis[(2,2-Dimethyl-1,3-Dioxolan-4-Yl)Methyl]Carbodiimide No suppilers available for the product. |
| Name | N,N'-Bis[(2,2-Dimethyl-1,3-Dioxolan-4-Yl)Methyl]Carbodiimide |
|---|---|
| Synonyms | 4-[5-(2,2 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.32 |
| CAS Registry Number | 159390-26-8 |
| SMILES | N(=C=N/CC1OC(OC1)(C)C)\CC2OC(OC2)(C)C |
| InChI | 1S/C13H22N2O4/c1-12(2)16-7-10(18-12)5-14-9-15-6-11-8-17-13(3,4)19-11/h10-11H,5-8H2,1-4H3 |
| InChIKey | QHHHYLFZGYIBCX-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 342.792°C at 760 mmHg (Cal.) |
| Flash point | 131.334°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N'-Bis[(2,2-Dimethyl-1,3-Dioxolan-4-Yl)Methyl]Carbodiimide |